C17H17N3O6 — CID 53308989
8-(3,4,5-trimethoxyphenyl)-11-oxa-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3(7)-diene-6,10-dione (PubChem CID 53308989) has the molecular formula C17H17N3O6 and a molecular weight of 359.34 g/mol. Its IUPAC name is 8-(3,4,5-trimethoxyphenyl)-11-oxa-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3(7)-diene-6,10-dione.
| Compound Name | 8-(3,4,5-trimethoxyphenyl)-11-oxa-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3(7)-diene-6,10-dione |
|---|---|
| PubChem CID | 53308989 |
| Molecular Formula | C17H17N3O6 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 8-(3,4,5-trimethoxyphenyl)-11-oxa-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3(7)-diene-6,10-dione |
| SMILES | COc1cc(C2C3=C(COC3=O)Nc3[nH][nH]c(=O)c32)cc(OC)c1OC |
| InChI | InChI=1S/C17H17N3O6/c1-23-9-4-7(5-10(24-2)14(9)25-3)11-12-8(6-26-17(12)22)18-15-13(11)16(21)20-19-15/h4-5,11H,6H2,1-3H3,(H3,18,19,20,21) |
| InChIKey | URSCCTGFSXMTNB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |