C27H37NO8 — CID 53310069
[(1S,2S,6S)-4-[(2-hexanoyloxybenzoyl)amino]-5,5-dimethoxy-7-oxabicyclo[4.1.0]hept-3-en-2-yl] hexanoate (PubChem CID 53310069) has the molecular formula C27H37NO8 and a molecular weight of 503.59 g/mol. Its IUPAC name is [(1S,2S,6S)-4-[(2-hexanoyloxybenzoyl)amino]-5,5-dimethoxy-7-oxabicyclo[4.1.0]hept-3-en-2-yl] hexanoate.
| Compound Name | [(1S,2S,6S)-4-[(2-hexanoyloxybenzoyl)amino]-5,5-dimethoxy-7-oxabicyclo[4.1.0]hept-3-en-2-yl] hexanoate |
|---|---|
| PubChem CID | 53310069 |
| Molecular Formula | C27H37NO8 |
| Molecular Weight | 503.59 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | [(1S,2S,6S)-4-[(2-hexanoyloxybenzoyl)amino]-5,5-dimethoxy-7-oxabicyclo[4.1.0]hept-3-en-2-yl] hexanoate |
| SMILES | CCCCCC(=O)Oc1ccccc1C(=O)NC1=C[C@H](OC(=O)CCCCC)[C@@H]2O[C@@H]2C1(OC)OC |
| InChI | InChI=1S/C27H37NO8/c1-5-7-9-15-22(29)34-19-14-12-11-13-18(19)26(31)28-21-17-20(35-23(30)16-10-8-6-2)24-25(36-24)27(21,32-3)33-4/h11-14,17,20,24-25H,5-10,15-16H2,1-4H3,(H,28,31)/t20-,24-,25-/m0/s1 |
| InChIKey | IOWJGCAECYMOHQ-OPXMRZJTSA-N |
| XLogP | 4.05 |
| TPSA | 112.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.59 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|