C29H37N5O6 — CID 53310223
[(1S)-1-[(5S,6S,7S,8R,9R)-8-amino-7-azido-9-hydroxy-2,2,9-trimethyl-6-(3-prop-1-en-2-ylanilino)-1,3-dioxaspiro[4.4]nonan-8-yl]ethyl] 4-methoxybenzoate (PubChem CID 53310223) has the molecular formula C29H37N5O6 and a molecular weight of 551.64 g/mol. Its IUPAC name is [(1S)-1-[(5S,6S,7S,8R,9R)-8-amino-7-azido-9-hydroxy-2,2,9-trimethyl-6-(3-prop-1-en-2-ylanilino)-1,3-dioxaspiro[4.4]nonan-8-yl]ethyl] 4-methoxybenzoate.
| Compound Name | [(1S)-1-[(5S,6S,7S,8R,9R)-8-amino-7-azido-9-hydroxy-2,2,9-trimethyl-6-(3-prop-1-en-2-ylanilino)-1,3-dioxaspiro[4.4]nonan-8-yl]ethyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 53310223 |
| Molecular Formula | C29H37N5O6 |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.27 |
| IUPAC Name | [(1S)-1-[(5S,6S,7S,8R,9R)-8-amino-7-azido-9-hydroxy-2,2,9-trimethyl-6-(3-prop-1-en-2-ylanilino)-1,3-dioxaspiro[4.4]nonan-8-yl]ethyl] 4-methoxybenzoate |
| SMILES | C=C(C)c1cccc(N[C@H]2[C@H](N=[N+]=[N-])[C@@](N)([C@H](C)OC(=O)c3ccc(OC)cc3)[C@@](C)(O)[C@@]23COC(C)(C)O3)c1 |
| InChI | InChI=1S/C29H37N5O6/c1-17(2)20-9-8-10-21(15-20)32-23-24(33-34-31)29(30,27(6,36)28(23)16-38-26(4,5)40-28)18(3)39-25(35)19-11-13-22(37-7)14-12-19/h8-15,18,23-24,32,36H,1,16,30H2,2-7H3/t18-,23-,24-,27-,28+,29-/m0/s1 |
| InChIKey | DLFQZRXVHJATIJ-CXTNVLNBSA-N |
| XLogP | 4.42 |
| TPSA | 161.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|