C26H26N6O5 — CID 53316471
2-[2-[(4-cyclohexylphenyl)methylamino]-6-(4-nitrophenoxy)purin-9-yl]acetic acid (PubChem CID 53316471) has the molecular formula C26H26N6O5 and a molecular weight of 502.53 g/mol. Its IUPAC name is 2-[2-[(4-cyclohexylphenyl)methylamino]-6-(4-nitrophenoxy)purin-9-yl]acetic acid.
| Compound Name | 2-[2-[(4-cyclohexylphenyl)methylamino]-6-(4-nitrophenoxy)purin-9-yl]acetic acid |
|---|---|
| PubChem CID | 53316471 |
| Molecular Formula | C26H26N6O5 |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | 2-[2-[(4-cyclohexylphenyl)methylamino]-6-(4-nitrophenoxy)purin-9-yl]acetic acid |
| SMILES | O=C(O)Cn1cnc2c(Oc3ccc([N+](=O)[O-])cc3)nc(NCc3ccc(C4CCCCC4)cc3)nc21 |
| InChI | InChI=1S/C26H26N6O5/c33-22(34)15-31-16-28-23-24(31)29-26(30-25(23)37-21-12-10-20(11-13-21)32(35)36)27-14-17-6-8-19(9-7-17)18-4-2-1-3-5-18/h6-13,16,18H,1-5,14-15H2,(H,33,34)(H,27,29,30) |
| InChIKey | VPBXSGJXHXOQAQ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|