C23H28N6O7 — CID 53323070
2-[2-[(2-methylpropan-2-yl)oxycarbonyl-pentylamino]-6-(4-nitrophenoxy)purin-9-yl]acetic acid (PubChem CID 53323070) has the molecular formula C23H28N6O7 and a molecular weight of 500.51 g/mol. Its IUPAC name is 2-[2-[(2-methylpropan-2-yl)oxycarbonyl-pentylamino]-6-(4-nitrophenoxy)purin-9-yl]acetic acid.
| Compound Name | 2-[2-[(2-methylpropan-2-yl)oxycarbonyl-pentylamino]-6-(4-nitrophenoxy)purin-9-yl]acetic acid |
|---|---|
| PubChem CID | 53323070 |
| Molecular Formula | C23H28N6O7 |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 2-[2-[(2-methylpropan-2-yl)oxycarbonyl-pentylamino]-6-(4-nitrophenoxy)purin-9-yl]acetic acid |
| SMILES | CCCCCN(C(=O)OC(C)(C)C)c1nc(Oc2ccc([N+](=O)[O-])cc2)c2ncn(CC(=O)O)c2n1 |
| InChI | InChI=1S/C23H28N6O7/c1-5-6-7-12-28(22(32)36-23(2,3)4)21-25-19-18(24-14-27(19)13-17(30)31)20(26-21)35-16-10-8-15(9-11-16)29(33)34/h8-11,14H,5-7,12-13H2,1-4H3,(H,30,31) |
| InChIKey | QBXXSFDNFHILBB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 162.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|