C26H47Cl2N5O — CID 53316905
N-[9-(diaminomethylideneamino)nonyl]-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide;dihydrochloride (PubChem CID 53316905) has the molecular formula C26H47Cl2N5O and a molecular weight of 516.60 g/mol. Its IUPAC name is N-[9-(diaminomethylideneamino)nonyl]-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide;dihydrochloride.
| Compound Name | N-[9-(diaminomethylideneamino)nonyl]-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide;dihydrochloride |
|---|---|
| PubChem CID | 53316905 |
| Molecular Formula | C26H47Cl2N5O |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 515.32 |
| IUPAC Name | N-[9-(diaminomethylideneamino)nonyl]-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide;dihydrochloride |
| SMILES | CCC(=O)N(CCCCCCCCCN=C(N)N)C1CCN(CCc2ccccc2)CC1.Cl.Cl |
| InChI | InChI=1S/C26H45N5O.2ClH/c1-2-25(32)31(19-12-7-5-3-4-6-11-18-29-26(27)28)24-16-21-30(22-17-24)20-15-23-13-9-8-10-14-23;;/h8-10,13-14,24H,2-7,11-12,15-22H2,1H3,(H4,27,28,29);2*1H |
| InChIKey | OJLPJDCXRRTKIA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|