C40H56N6O8 — CID 53318328
tert-butyl N-[(3S)-3-[[(2S)-3-cyclohexyl-2-(morpholine-4-carbonylamino)propanoyl]amino]-4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethylamino]-4-oxobutyl]carbamate (PubChem CID 53318328) has the molecular formula C40H56N6O8 and a molecular weight of 748.92 g/mol. Its IUPAC name is tert-butyl N-[(3S)-3-[[(2S)-3-cyclohexyl-2-(morpholine-4-carbonylamino)propanoyl]amino]-4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethylamino]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[(3S)-3-[[(2S)-3-cyclohexyl-2-(morpholine-4-carbonylamino)propanoyl]amino]-4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethylamino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 53318328 |
| Molecular Formula | C40H56N6O8 |
| Molecular Weight | 748.92 g/mol |
| Exact Mass | 748.42 |
| IUPAC Name | tert-butyl N-[(3S)-3-[[(2S)-3-cyclohexyl-2-(morpholine-4-carbonylamino)propanoyl]amino]-4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethylamino]-4-oxobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC[C@H](NC(=O)[C@H](CC1CCCCC1)NC(=O)N1CCOCC1)C(=O)NCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C40H56N6O8/c1-40(2,3)54-39(51)42-18-17-33(44-36(48)34(25-27-11-5-4-6-12-27)45-37(49)46-21-23-52-24-22-46)35(47)41-19-20-43-38(50)53-26-32-30-15-9-7-13-28(30)29-14-8-10-16-31(29)32/h7-10,13-16,27,32-34H,4-6,11-12,17-26H2,1-3H3,(H,41,47)(H,42,51)(H,43,50)(H,44,48)(H,45,49)/t33-,34-/m0/s1 |
| InChIKey | IBLRQAPJNRQYMK-HEVIKAOCSA-N |
| XLogP | 4.42 |
| TPSA | 176.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.92 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|