C18H17N5O3S — CID 53319164
1-[(Z)-[2-[(3-oxido-2,1,3-benzoxadiazol-3-ium-5-yl)methoxy]phenyl]methylideneamino]-3-prop-2-enylthiourea (PubChem CID 53319164) has the molecular formula C18H17N5O3S and a molecular weight of 383.43 g/mol. Its IUPAC name is 1-[(Z)-[2-[(3-oxido-2,1,3-benzoxadiazol-3-ium-5-yl)methoxy]phenyl]methylideneamino]-3-prop-2-enylthiourea.
| Compound Name | 1-[(Z)-[2-[(3-oxido-2,1,3-benzoxadiazol-3-ium-5-yl)methoxy]phenyl]methylideneamino]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 53319164 |
| Molecular Formula | C18H17N5O3S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 1-[(Z)-[2-[(3-oxido-2,1,3-benzoxadiazol-3-ium-5-yl)methoxy]phenyl]methylideneamino]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)N/N=C\c1ccccc1OCc1ccc2no[n+]([O-])c2c1 |
| InChI | InChI=1S/C18H17N5O3S/c1-2-9-19-18(27)21-20-11-14-5-3-4-6-17(14)25-12-13-7-8-15-16(10-13)23(24)26-22-15/h2-8,10-11H,1,9,12H2,(H2,19,21,27)/b20-11- |
| InChIKey | LDDGEUWLQAKVKR-JAIQZWGSSA-N |
| XLogP | 2.02 |
| TPSA | 98.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|