C16H12N2OS — CID 53322663
(4-imidazo[2,1-b][1,3]benzothiazol-2-ylphenyl)methanol (PubChem CID 53322663) has the molecular formula C16H12N2OS and a molecular weight of 280.35 g/mol. Its IUPAC name is (4-imidazo[2,1-b][1,3]benzothiazol-2-ylphenyl)methanol.
| Compound Name | (4-imidazo[2,1-b][1,3]benzothiazol-2-ylphenyl)methanol |
|---|---|
| PubChem CID | 53322663 |
| Molecular Formula | C16H12N2OS |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | (4-imidazo[2,1-b][1,3]benzothiazol-2-ylphenyl)methanol |
| SMILES | OCc1ccc(-c2cn3c(n2)sc2ccccc23)cc1 |
| InChI | InChI=1S/C16H12N2OS/c19-10-11-5-7-12(8-6-11)13-9-18-14-3-1-2-4-15(14)20-16(18)17-13/h1-9,19H,10H2 |
| InChIKey | BYLUSHHYKKRQPO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |