C35H28F4N4O4S — CID 53322907
benzyl (2S)-2-[[4-[2-(3-fluorophenyl)imino-4-oxo-3-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazolidin-5-yl]phenyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 53322907) has the molecular formula C35H28F4N4O4S and a molecular weight of 676.69 g/mol. Its IUPAC name is benzyl (2S)-2-[[4-[2-(3-fluorophenyl)imino-4-oxo-3-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazolidin-5-yl]phenyl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-[[4-[2-(3-fluorophenyl)imino-4-oxo-3-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazolidin-5-yl]phenyl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 53322907 |
| Molecular Formula | C35H28F4N4O4S |
| Molecular Weight | 676.69 g/mol |
| Exact Mass | 676.18 |
| IUPAC Name | benzyl (2S)-2-[[4-[2-(3-fluorophenyl)imino-4-oxo-3-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazolidin-5-yl]phenyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | O=C(Nc1ccc(C2S/C(=N\c3cccc(F)c3)N(Cc3ccc(F)c(F)c3F)C2=O)cc1)[C@@H]1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C35H28F4N4O4S/c36-24-8-4-9-26(18-24)41-34-43(19-23-13-16-27(37)30(39)29(23)38)33(45)31(48-34)22-11-14-25(15-12-22)40-32(44)28-10-5-17-42(28)35(46)47-20-21-6-2-1-3-7-21/h1-4,6-9,11-16,18,28,31H,5,10,17,19-20H2,(H,40,44)/b41-34-/t28-,31?/m0/s1 |
| InChIKey | OWMAKUBUVXVPGM-DTJCPNHVSA-N |
| XLogP | 7.49 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.69 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|