C23H16N3O2+ — CID 53322946
(3R,4R)-3-(1-azoniatricyclo[6.3.1.04,12]dodeca-1(11),2,4,6,8(12),9-hexaen-3-yl)-4-(1H-indol-3-yl)pyrrolidine-2,5-dione (PubChem CID 53322946) has the molecular formula C23H16N3O2+ and a molecular weight of 366.40 g/mol. Its IUPAC name is (3R,4R)-3-(1-azoniatricyclo[6.3.1.04,12]dodeca-1(11),2,4,6,8(12),9-hexaen-3-yl)-4-(1H-indol-3-yl)pyrrolidine-2,5-dione.
| Compound Name | (3R,4R)-3-(1-azoniatricyclo[6.3.1.04,12]dodeca-1(11),2,4,6,8(12),9-hexaen-3-yl)-4-(1H-indol-3-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 53322946 |
| Molecular Formula | C23H16N3O2+ |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (3R,4R)-3-(1-azoniatricyclo[6.3.1.04,12]dodeca-1(11),2,4,6,8(12),9-hexaen-3-yl)-4-(1H-indol-3-yl)pyrrolidine-2,5-dione |
| SMILES | O=C1NC(=O)[C@@H](c2c[nH]c3ccccc23)[C@@H]1C1=C[n+]2cccc3cccc1c32 |
| InChI | InChI=1S/C23H15N3O2/c27-22-19(16-11-24-18-9-2-1-7-14(16)18)20(23(28)25-22)17-12-26-10-4-6-13-5-3-8-15(17)21(13)26/h1-12,19-20,24H/p+1/t19-,20-/m0/s1 |
| InChIKey | DVSVKPFSHABFPS-PMACEKPBSA-O |
| XLogP | 2.98 |
| TPSA | 65.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|