C16H8Cl3FO4 — CID 53323912
5-fluoro-2-hydroxy-3-[(E)-3-(2,3,6-trichlorophenyl)prop-2-enoyl]benzoic acid (PubChem CID 53323912) has the molecular formula C16H8Cl3FO4 and a molecular weight of 389.59 g/mol. Its IUPAC name is 5-fluoro-2-hydroxy-3-[(E)-3-(2,3,6-trichlorophenyl)prop-2-enoyl]benzoic acid.
| Compound Name | 5-fluoro-2-hydroxy-3-[(E)-3-(2,3,6-trichlorophenyl)prop-2-enoyl]benzoic acid |
|---|---|
| PubChem CID | 53323912 |
| Molecular Formula | C16H8Cl3FO4 |
| Molecular Weight | 389.59 g/mol |
| Exact Mass | 387.95 |
| IUPAC Name | 5-fluoro-2-hydroxy-3-[(E)-3-(2,3,6-trichlorophenyl)prop-2-enoyl]benzoic acid |
| SMILES | O=C(O)c1cc(F)cc(C(=O)/C=C/c2c(Cl)ccc(Cl)c2Cl)c1O |
| InChI | InChI=1S/C16H8Cl3FO4/c17-11-2-3-12(18)14(19)8(11)1-4-13(21)9-5-7(20)6-10(15(9)22)16(23)24/h1-6,22H,(H,23,24)/b4-1+ |
| InChIKey | FZGREZXJUXEWOQ-DAFODLJHSA-N |
| XLogP | 5.09 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.59 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|