C30H34N4O3 — CID 53326855
(2R,3S)-3-benzyl-2-[4-(4-methylpiperazin-1-yl)phenoxy]-4-oxo-N-[(1R)-1-phenylethyl]azetidine-1-carboxamide (PubChem CID 53326855) has the molecular formula C30H34N4O3 and a molecular weight of 498.63 g/mol. Its IUPAC name is (2R,3S)-3-benzyl-2-[4-(4-methylpiperazin-1-yl)phenoxy]-4-oxo-N-[(1R)-1-phenylethyl]azetidine-1-carboxamide.
| Compound Name | (2R,3S)-3-benzyl-2-[4-(4-methylpiperazin-1-yl)phenoxy]-4-oxo-N-[(1R)-1-phenylethyl]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 53326855 |
| Molecular Formula | C30H34N4O3 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | (2R,3S)-3-benzyl-2-[4-(4-methylpiperazin-1-yl)phenoxy]-4-oxo-N-[(1R)-1-phenylethyl]azetidine-1-carboxamide |
| SMILES | C[C@@H](NC(=O)N1C(=O)[C@@H](Cc2ccccc2)[C@H]1Oc1ccc(N2CCN(C)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H34N4O3/c1-22(24-11-7-4-8-12-24)31-30(36)34-28(35)27(21-23-9-5-3-6-10-23)29(34)37-26-15-13-25(14-16-26)33-19-17-32(2)18-20-33/h3-16,22,27,29H,17-21H2,1-2H3,(H,31,36)/t22-,27-,29-/m1/s1 |
| InChIKey | VJHJFXLNIQUNTR-SGNYCRIWSA-N |
| XLogP | 4.32 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|