C16H21N3 — CID 53327265
(7S)-5-propyl-2,5,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9,12(16),13-tetraene (PubChem CID 53327265) has the molecular formula C16H21N3 and a molecular weight of 255.37 g/mol. Its IUPAC name is (7S)-5-propyl-2,5,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9,12(16),13-tetraene.
| Compound Name | (7S)-5-propyl-2,5,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9,12(16),13-tetraene |
|---|---|
| PubChem CID | 53327265 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | (7S)-5-propyl-2,5,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9,12(16),13-tetraene |
| SMILES | CCCN1CCN2c3cccc4[nH]cc(c34)C[C@H]2C1 |
| InChI | InChI=1S/C16H21N3/c1-2-6-18-7-8-19-13(11-18)9-12-10-17-14-4-3-5-15(19)16(12)14/h3-5,10,13,17H,2,6-9,11H2,1H3/t13-/m0/s1 |
| InChIKey | WDTMSPNCLRUYLZ-ZDUSSCGKSA-N |
| XLogP | 2.62 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |