C13H15ClN6OS — CID 53328223
5-(4-chloro-5-methylsulfanyl-6-morpholin-4-ylpyrimidin-2-yl)pyrimidin-2-amine (PubChem CID 53328223) has the molecular formula C13H15ClN6OS and a molecular weight of 338.82 g/mol. Its IUPAC name is 5-(4-chloro-5-methylsulfanyl-6-morpholin-4-ylpyrimidin-2-yl)pyrimidin-2-amine.
| Compound Name | 5-(4-chloro-5-methylsulfanyl-6-morpholin-4-ylpyrimidin-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 53328223 |
| Molecular Formula | C13H15ClN6OS |
| Molecular Weight | 338.82 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 5-(4-chloro-5-methylsulfanyl-6-morpholin-4-ylpyrimidin-2-yl)pyrimidin-2-amine |
| SMILES | CSc1c(Cl)nc(-c2cnc(N)nc2)nc1N1CCOCC1 |
| InChI | InChI=1S/C13H15ClN6OS/c1-22-9-10(14)18-11(8-6-16-13(15)17-7-8)19-12(9)20-2-4-21-5-3-20/h6-7H,2-5H2,1H3,(H2,15,16,17) |
| InChIKey | ZFZQVPLBPVJBMV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 90.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.82 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |