C9H9ClN6S — CID 88918809
2-(2-aminopyrimidin-5-yl)-6-chloro-5-methylsulfanylpyrimidin-4-amine (PubChem CID 88918809) has the molecular formula C9H9ClN6S and a molecular weight of 268.73 g/mol. Its IUPAC name is 2-(2-aminopyrimidin-5-yl)-6-chloro-5-methylsulfanylpyrimidin-4-amine.
| Compound Name | 2-(2-aminopyrimidin-5-yl)-6-chloro-5-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 88918809 |
| Molecular Formula | C9H9ClN6S |
| Molecular Weight | 268.73 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 2-(2-aminopyrimidin-5-yl)-6-chloro-5-methylsulfanylpyrimidin-4-amine |
| SMILES | CSc1c(N)nc(-c2cnc(N)nc2)nc1Cl |
| InChI | InChI=1S/C9H9ClN6S/c1-17-5-6(10)15-8(16-7(5)11)4-2-13-9(12)14-3-4/h2-3H,1H3,(H2,11,15,16)(H2,12,13,14) |
| InChIKey | BHGSDAVKJAISSO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.73 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |