C19H40N8O3 — CID 53329456
(2S)-2-acetamido-6-amino-N-[(2S)-6-amino-1-[4-(diaminomethylideneamino)butylamino]-1-oxohexan-2-yl]hexanamide (PubChem CID 53329456) has the molecular formula C19H40N8O3 and a molecular weight of 428.58 g/mol. Its IUPAC name is (2S)-2-acetamido-6-amino-N-[(2S)-6-amino-1-[4-(diaminomethylideneamino)butylamino]-1-oxohexan-2-yl]hexanamide.
| Compound Name | (2S)-2-acetamido-6-amino-N-[(2S)-6-amino-1-[4-(diaminomethylideneamino)butylamino]-1-oxohexan-2-yl]hexanamide |
|---|---|
| PubChem CID | 53329456 |
| Molecular Formula | C19H40N8O3 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.32 |
| IUPAC Name | (2S)-2-acetamido-6-amino-N-[(2S)-6-amino-1-[4-(diaminomethylideneamino)butylamino]-1-oxohexan-2-yl]hexanamide |
| SMILES | CC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)NCCCCN=C(N)N |
| InChI | InChI=1S/C19H40N8O3/c1-14(28)26-16(9-3-5-11-21)18(30)27-15(8-2-4-10-20)17(29)24-12-6-7-13-25-19(22)23/h15-16H,2-13,20-21H2,1H3,(H,24,29)(H,26,28)(H,27,30)(H4,22,23,25)/t15-,16-/m0/s1 |
| InChIKey | NUJKROBYYGWCPQ-HOTGVXAUSA-N |
| XLogP | -1.60 |
| TPSA | 203.74 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|