C17H35N7O2 — CID 10248541
N-[1,13-bis(diaminomethylideneamino)-5-oxotridecan-4-yl]acetamide (PubChem CID 10248541) has the molecular formula C17H35N7O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is N-[1,13-bis(diaminomethylideneamino)-5-oxotridecan-4-yl]acetamide.
| Compound Name | N-[1,13-bis(diaminomethylideneamino)-5-oxotridecan-4-yl]acetamide |
|---|---|
| PubChem CID | 10248541 |
| Molecular Formula | C17H35N7O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.29 |
| IUPAC Name | N-[1,13-bis(diaminomethylideneamino)-5-oxotridecan-4-yl]acetamide |
| SMILES | CC(=O)NC(CCCN=C(N)N)C(=O)CCCCCCCCN=C(N)N |
| InChI | InChI=1S/C17H35N7O2/c1-13(25)24-14(9-8-12-23-17(20)21)15(26)10-6-4-2-3-5-7-11-22-16(18)19/h14H,2-12H2,1H3,(H,24,25)(H4,18,19,22)(H4,20,21,23) |
| InChIKey | OFODYLDIASSKRR-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 174.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|