C21H19F6N5O3S — CID 53329678
(3R)-3-amino-1-(3-thiophen-2-yl-6,7-dihydro-4H-triazolo[1,5-a]pyrazin-5-yl)-4-(2,4,5-trifluorophenyl)butan-1-one;2,2,2-trifluoroacetic acid (PubChem CID 53329678) has the molecular formula C21H19F6N5O3S and a molecular weight of 535.47 g/mol. Its IUPAC name is (3R)-3-amino-1-(3-thiophen-2-yl-6,7-dihydro-4H-triazolo[1,5-a]pyrazin-5-yl)-4-(2,4,5-trifluorophenyl)butan-1-one;2,2,2-trifluoroacetic acid.
| Compound Name | (3R)-3-amino-1-(3-thiophen-2-yl-6,7-dihydro-4H-triazolo[1,5-a]pyrazin-5-yl)-4-(2,4,5-trifluorophenyl)butan-1-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 53329678 |
| Molecular Formula | C21H19F6N5O3S |
| Molecular Weight | 535.47 g/mol |
| Exact Mass | 535.11 |
| IUPAC Name | (3R)-3-amino-1-(3-thiophen-2-yl-6,7-dihydro-4H-triazolo[1,5-a]pyrazin-5-yl)-4-(2,4,5-trifluorophenyl)butan-1-one;2,2,2-trifluoroacetic acid |
| SMILES | N[C@@H](CC(=O)N1CCn2nnc(-c3cccs3)c2C1)Cc1cc(F)c(F)cc1F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H18F3N5OS.C2HF3O2/c20-13-9-15(22)14(21)7-11(13)6-12(23)8-18(28)26-3-4-27-16(10-26)19(24-25-27)17-2-1-5-29-17;3-2(4,5)1(6)7/h1-2,5,7,9,12H,3-4,6,8,10,23H2;(H,6,7)/t12-;/m1./s1 |
| InChIKey | DSJSLZCEPPJSPE-UTONKHPSSA-N |
| XLogP | 3.36 |
| TPSA | 114.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|