C24H29N3O2 — CID 53329887
6-[2-(2,2-dimethylpropoxy)phenyl]-3-morpholin-4-ylquinolin-2-amine (PubChem CID 53329887) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 6-[2-(2,2-dimethylpropoxy)phenyl]-3-morpholin-4-ylquinolin-2-amine.
| Compound Name | 6-[2-(2,2-dimethylpropoxy)phenyl]-3-morpholin-4-ylquinolin-2-amine |
|---|---|
| PubChem CID | 53329887 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 6-[2-(2,2-dimethylpropoxy)phenyl]-3-morpholin-4-ylquinolin-2-amine |
| SMILES | CC(C)(C)COc1ccccc1-c1ccc2nc(N)c(N3CCOCC3)cc2c1 |
| InChI | InChI=1S/C24H29N3O2/c1-24(2,3)16-29-22-7-5-4-6-19(22)17-8-9-20-18(14-17)15-21(23(25)26-20)27-10-12-28-13-11-27/h4-9,14-15H,10-13,16H2,1-3H3,(H2,25,26) |
| InChIKey | QRDHWWWEHHROCV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |