C27H27N3O — CID 71260946
6-[2-methyl-6-(3-methylphenyl)phenyl]-3-morpholin-4-ylquinolin-2-amine (PubChem CID 71260946) has the molecular formula C27H27N3O and a molecular weight of 409.53 g/mol. Its IUPAC name is 6-[2-methyl-6-(3-methylphenyl)phenyl]-3-morpholin-4-ylquinolin-2-amine.
| Compound Name | 6-[2-methyl-6-(3-methylphenyl)phenyl]-3-morpholin-4-ylquinolin-2-amine |
|---|---|
| PubChem CID | 71260946 |
| Molecular Formula | C27H27N3O |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 6-[2-methyl-6-(3-methylphenyl)phenyl]-3-morpholin-4-ylquinolin-2-amine |
| SMILES | Cc1cccc(-c2cccc(C)c2-c2ccc3nc(N)c(N4CCOCC4)cc3c2)c1 |
| InChI | InChI=1S/C27H27N3O/c1-18-5-3-7-20(15-18)23-8-4-6-19(2)26(23)21-9-10-24-22(16-21)17-25(27(28)29-24)30-11-13-31-14-12-30/h3-10,15-17H,11-14H2,1-2H3,(H2,28,29) |
| InChIKey | BYJVVOVMACEHGF-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |