C25H26N4O2 — CID 90309323
2-[2-(2-amino-3-morpholin-4-ylquinolin-6-yl)-3-methylphenyl]-2,5-dihydropyrrole-1-carbaldehyde (PubChem CID 90309323) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-[2-(2-amino-3-morpholin-4-ylquinolin-6-yl)-3-methylphenyl]-2,5-dihydropyrrole-1-carbaldehyde.
| Compound Name | 2-[2-(2-amino-3-morpholin-4-ylquinolin-6-yl)-3-methylphenyl]-2,5-dihydropyrrole-1-carbaldehyde |
|---|---|
| PubChem CID | 90309323 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 2-[2-(2-amino-3-morpholin-4-ylquinolin-6-yl)-3-methylphenyl]-2,5-dihydropyrrole-1-carbaldehyde |
| SMILES | Cc1cccc(C2C=CCN2C=O)c1-c1ccc2nc(N)c(N3CCOCC3)cc2c1 |
| InChI | InChI=1S/C25H26N4O2/c1-17-4-2-5-20(22-6-3-9-29(22)16-30)24(17)18-7-8-21-19(14-18)15-23(25(26)27-21)28-10-12-31-13-11-28/h2-8,14-16,22H,9-13H2,1H3,(H2,26,27) |
| InChIKey | QYUIBEBMTILWEO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|