C27H28N4O3 — CID 90309318
2-[2-(2-amino-3-morpholin-4-ylquinolin-6-yl)-3-methylphenyl]-3-methoxy-1H-pyridine-2-carbaldehyde (PubChem CID 90309318) has the molecular formula C27H28N4O3 and a molecular weight of 456.55 g/mol. Its IUPAC name is 2-[2-(2-amino-3-morpholin-4-ylquinolin-6-yl)-3-methylphenyl]-3-methoxy-1H-pyridine-2-carbaldehyde.
| Compound Name | 2-[2-(2-amino-3-morpholin-4-ylquinolin-6-yl)-3-methylphenyl]-3-methoxy-1H-pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 90309318 |
| Molecular Formula | C27H28N4O3 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 2-[2-(2-amino-3-morpholin-4-ylquinolin-6-yl)-3-methylphenyl]-3-methoxy-1H-pyridine-2-carbaldehyde |
| SMILES | COC1=CC=CNC1(C=O)c1cccc(C)c1-c1ccc2nc(N)c(N3CCOCC3)cc2c1 |
| InChI | InChI=1S/C27H28N4O3/c1-18-5-3-6-21(27(17-32)24(33-2)7-4-10-29-27)25(18)19-8-9-22-20(15-19)16-23(26(28)30-22)31-11-13-34-14-12-31/h3-10,15-17,29H,11-14H2,1-2H3,(H2,28,30) |
| InChIKey | VQGHGXOXJNRDJC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|