C15H18BrN3 — CID 53329953
4-(1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-2-ium-2-ylmethyl)benzonitrile bromide (PubChem CID 53329953) has the molecular formula C15H18BrN3 and a molecular weight of 320.23 g/mol. Its IUPAC name is 4-(1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-2-ium-2-ylmethyl)benzonitrile bromide.
| Compound Name | 4-(1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-2-ium-2-ylmethyl)benzonitrile bromide |
|---|---|
| PubChem CID | 53329953 |
| Molecular Formula | C15H18BrN3 |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 4-(1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-2-ium-2-ylmethyl)benzonitrile bromide |
| SMILES | N#Cc1ccc(C[N+]2=CN3CCCCC3C2)cc1.[Br-] |
| InChI | InChI=1S/C15H18N3.BrH/c16-9-13-4-6-14(7-5-13)10-17-11-15-3-1-2-8-18(15)12-17;/h4-7,12,15H,1-3,8,10-11H2;1H/q+1;/p-1 |
| InChIKey | RAMIGYPJQIGYCN-UHFFFAOYSA-M |
| XLogP | -1.03 |
| TPSA | 30.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|