C23H21N5OS — CID 53332111
11-(3,4-dimethylphenyl)-5-[(4-methoxyphenyl)methylsulfanyl]-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene (PubChem CID 53332111) has the molecular formula C23H21N5OS and a molecular weight of 415.52 g/mol. Its IUPAC name is 11-(3,4-dimethylphenyl)-5-[(4-methoxyphenyl)methylsulfanyl]-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene.
| Compound Name | 11-(3,4-dimethylphenyl)-5-[(4-methoxyphenyl)methylsulfanyl]-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene |
|---|---|
| PubChem CID | 53332111 |
| Molecular Formula | C23H21N5OS |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 11-(3,4-dimethylphenyl)-5-[(4-methoxyphenyl)methylsulfanyl]-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene |
| SMILES | COc1ccc(CSc2nnc3c4cc(-c5ccc(C)c(C)c5)nn4ccn23)cc1 |
| InChI | InChI=1S/C23H21N5OS/c1-15-4-7-18(12-16(15)2)20-13-21-22-24-25-23(27(22)10-11-28(21)26-20)30-14-17-5-8-19(29-3)9-6-17/h4-13H,14H2,1-3H3 |
| InChIKey | MLHPWJWYNGTKIZ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 56.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |