C17H17N5S — CID 53332100
11-(3,4-dimethylphenyl)-5-ethylsulfanyl-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene (PubChem CID 53332100) has the molecular formula C17H17N5S and a molecular weight of 323.43 g/mol. Its IUPAC name is 11-(3,4-dimethylphenyl)-5-ethylsulfanyl-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene.
| Compound Name | 11-(3,4-dimethylphenyl)-5-ethylsulfanyl-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene |
|---|---|
| PubChem CID | 53332100 |
| Molecular Formula | C17H17N5S |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 11-(3,4-dimethylphenyl)-5-ethylsulfanyl-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene |
| SMILES | CCSc1nnc2c3cc(-c4ccc(C)c(C)c4)nn3ccn12 |
| InChI | InChI=1S/C17H17N5S/c1-4-23-17-19-18-16-15-10-14(20-22(15)8-7-21(16)17)13-6-5-11(2)12(3)9-13/h5-10H,4H2,1-3H3 |
| InChIKey | XGMXIAMEQYTBPP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 47.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |