C24H21F2N5OS — CID 53332160
11-(4-butoxyphenyl)-5-[(2,4-difluorophenyl)methylsulfanyl]-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene (PubChem CID 53332160) has the molecular formula C24H21F2N5OS and a molecular weight of 465.53 g/mol. Its IUPAC name is 11-(4-butoxyphenyl)-5-[(2,4-difluorophenyl)methylsulfanyl]-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene.
| Compound Name | 11-(4-butoxyphenyl)-5-[(2,4-difluorophenyl)methylsulfanyl]-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene |
|---|---|
| PubChem CID | 53332160 |
| Molecular Formula | C24H21F2N5OS |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 11-(4-butoxyphenyl)-5-[(2,4-difluorophenyl)methylsulfanyl]-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene |
| SMILES | CCCCOc1ccc(-c2cc3c4nnc(SCc5ccc(F)cc5F)n4ccn3n2)cc1 |
| InChI | InChI=1S/C24H21F2N5OS/c1-2-3-12-32-19-8-5-16(6-9-19)21-14-22-23-27-28-24(30(23)10-11-31(22)29-21)33-15-17-4-7-18(25)13-20(17)26/h4-11,13-14H,2-3,12,15H2,1H3 |
| InChIKey | RJHRIBNTUJQGRR-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 56.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|