About 5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyridine-8-carboxylic acid
5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyridine-8-carboxylic acid (PubChem CID 53337821) has the molecular formula C8H8N2O3
and a molecular weight of 180.16 g/mol. Its IUPAC name is 5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyridine-8-carboxylic acid.
Analyze 5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyridine-8-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyridine-8-carboxylic acid?
The IUPAC name of 5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyridine-8-carboxylic acid (CID 53337821) is 5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyridine-8-carboxylic acid.
What is the SMILES notation for 5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyridine-8-carboxylic acid?
The canonical SMILES for 5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyridine-8-carboxylic acid is O=C(O)c1ccc(=O)n2c1NCC2.
What is the InChIKey of 5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyridine-8-carboxylic acid?
The InChIKey is GCVCGPPYESIYPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O3/c11-6-2-1-5(8(12)13)7-9-3-4-10(6)7/h1-2,9H,3-4H2,(H,12,13).
What are the key properties of 5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyridine-8-carboxylic acid?
5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyridine-8-carboxylic acid has a molecular weight of 180.16 g/mol, XLogP of -0.03, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyridine-8-carboxylic acid is sourced from PubChem (CID 53337821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).