C18H18N2O2 — CID 59995779
10-benzoyl-1,8-diazatricyclo[7.4.0.03,6]trideca-9,11-dien-13-one (PubChem CID 59995779) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is 10-benzoyl-1,8-diazatricyclo[7.4.0.03,6]trideca-9,11-dien-13-one.
| Compound Name | 10-benzoyl-1,8-diazatricyclo[7.4.0.03,6]trideca-9,11-dien-13-one |
|---|---|
| PubChem CID | 59995779 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 10-benzoyl-1,8-diazatricyclo[7.4.0.03,6]trideca-9,11-dien-13-one |
| SMILES | O=C(c1ccccc1)c1ccc(=O)n2c1NCC1CCC1C2 |
| InChI | InChI=1S/C18H18N2O2/c21-16-9-8-15(17(22)12-4-2-1-3-5-12)18-19-10-13-6-7-14(13)11-20(16)18/h1-5,8-9,13-14,19H,6-7,10-11H2 |
| InChIKey | LIKYEGQMFZEAHU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |