C19H16N2O — CID 10517462
7,8-diphenyl-2,3-dihydro-1H-imidazo[1,2-a]pyridin-5-one (PubChem CID 10517462) has the molecular formula C19H16N2O and a molecular weight of 288.35 g/mol. Its IUPAC name is 7,8-diphenyl-2,3-dihydro-1H-imidazo[1,2-a]pyridin-5-one.
| Compound Name | 7,8-diphenyl-2,3-dihydro-1H-imidazo[1,2-a]pyridin-5-one |
|---|---|
| PubChem CID | 10517462 |
| Molecular Formula | C19H16N2O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 7,8-diphenyl-2,3-dihydro-1H-imidazo[1,2-a]pyridin-5-one |
| SMILES | O=c1cc(-c2ccccc2)c(-c2ccccc2)c2n1CCN2 |
| InChI | InChI=1S/C19H16N2O/c22-17-13-16(14-7-3-1-4-8-14)18(15-9-5-2-6-10-15)19-20-11-12-21(17)19/h1-10,13,20H,11-12H2 |
| InChIKey | VONRZTMFVADDSB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |