C18H14N2O2 — CID 21463158
11-phenyl-3,4-dihydro-2H-pyrazino[1,2-b]isoquinoline-1,6-dione (PubChem CID 21463158) has the molecular formula C18H14N2O2 and a molecular weight of 290.32 g/mol. Its IUPAC name is 11-phenyl-3,4-dihydro-2H-pyrazino[1,2-b]isoquinoline-1,6-dione.
| Compound Name | 11-phenyl-3,4-dihydro-2H-pyrazino[1,2-b]isoquinoline-1,6-dione |
|---|---|
| PubChem CID | 21463158 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 11-phenyl-3,4-dihydro-2H-pyrazino[1,2-b]isoquinoline-1,6-dione |
| SMILES | O=C1NCCn2c1c(-c1ccccc1)c1ccccc1c2=O |
| InChI | InChI=1S/C18H14N2O2/c21-17-16-15(12-6-2-1-3-7-12)13-8-4-5-9-14(13)18(22)20(16)11-10-19-17/h1-9H,10-11H2,(H,19,21) |
| InChIKey | GPURVZXDZUBNGT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |