C17H14O4 — CID 53339390
(3Z)-3-benzylidene-8-hydroxy-7-methoxy-1H-isochromen-4-one (PubChem CID 53339390) has the molecular formula C17H14O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is (3Z)-3-benzylidene-8-hydroxy-7-methoxy-1H-isochromen-4-one.
| Compound Name | (3Z)-3-benzylidene-8-hydroxy-7-methoxy-1H-isochromen-4-one |
|---|---|
| PubChem CID | 53339390 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (3Z)-3-benzylidene-8-hydroxy-7-methoxy-1H-isochromen-4-one |
| SMILES | COc1ccc2c(c1O)CO/C(=C\c1ccccc1)C2=O |
| InChI | InChI=1S/C17H14O4/c1-20-14-8-7-12-13(17(14)19)10-21-15(16(12)18)9-11-5-3-2-4-6-11/h2-9,19H,10H2,1H3/b15-9- |
| InChIKey | LIFRAUCITYZKDD-DHDCSXOGSA-N |
| XLogP | 3.15 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|