C24H21BrN2O6 — CID 122193631
(3Z)-7,8-dimethoxy-3-[[1-[(3-nitrophenyl)methyl]pyridin-1-ium-4-yl]methylidene]-1H-isochromen-4-one bromide (PubChem CID 122193631) has the molecular formula C24H21BrN2O6 and a molecular weight of 513.34 g/mol. Its IUPAC name is (3Z)-7,8-dimethoxy-3-[[1-[(3-nitrophenyl)methyl]pyridin-1-ium-4-yl]methylidene]-1H-isochromen-4-one bromide.
| Compound Name | (3Z)-7,8-dimethoxy-3-[[1-[(3-nitrophenyl)methyl]pyridin-1-ium-4-yl]methylidene]-1H-isochromen-4-one bromide |
|---|---|
| PubChem CID | 122193631 |
| Molecular Formula | C24H21BrN2O6 |
| Molecular Weight | 513.34 g/mol |
| Exact Mass | 512.06 |
| IUPAC Name | (3Z)-7,8-dimethoxy-3-[[1-[(3-nitrophenyl)methyl]pyridin-1-ium-4-yl]methylidene]-1H-isochromen-4-one bromide |
| SMILES | COc1ccc2c(c1OC)CO/C(=C\c1cc[n+](Cc3cccc([N+](=O)[O-])c3)cc1)C2=O.[Br-] |
| InChI | InChI=1S/C24H21N2O6.BrH/c1-30-21-7-6-19-20(24(21)31-2)15-32-22(23(19)27)13-16-8-10-25(11-9-16)14-17-4-3-5-18(12-17)26(28)29;/h3-13H,14-15H2,1-2H3;1H/q+1;/p-1/b22-13-; |
| InChIKey | BLHPKPOXRHQXBK-BWLGBDCWSA-M |
| XLogP | 0.71 |
| TPSA | 91.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.34 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|