C26H24O6 — CID 10550673
(3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-7-methoxy-8-phenylmethoxychromen-4-one (PubChem CID 10550673) has the molecular formula C26H24O6 and a molecular weight of 432.47 g/mol. Its IUPAC name is (3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-7-methoxy-8-phenylmethoxychromen-4-one.
| Compound Name | (3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-7-methoxy-8-phenylmethoxychromen-4-one |
|---|---|
| PubChem CID | 10550673 |
| Molecular Formula | C26H24O6 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | (3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-7-methoxy-8-phenylmethoxychromen-4-one |
| SMILES | COc1ccc(/C=C2/COc3c(ccc(OC)c3OCc3ccccc3)C2=O)cc1OC |
| InChI | InChI=1S/C26H24O6/c1-28-21-11-9-18(14-23(21)30-3)13-19-16-32-25-20(24(19)27)10-12-22(29-2)26(25)31-15-17-7-5-4-6-8-17/h4-14H,15-16H2,1-3H3/b19-13- |
| InChIKey | WTZAFUQBTPGBOY-UYRXBGFRSA-N |
| XLogP | 4.95 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|