C28H33N5O — CID 53340253
(11R,12S)-11-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-12-phenyl-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13)-dien-4-one (PubChem CID 53340253) has the molecular formula C28H33N5O and a molecular weight of 455.61 g/mol. Its IUPAC name is (11R,12S)-11-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-12-phenyl-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13)-dien-4-one.
| Compound Name | (11R,12S)-11-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-12-phenyl-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13)-dien-4-one |
|---|---|
| PubChem CID | 53340253 |
| Molecular Formula | C28H33N5O |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | (11R,12S)-11-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-12-phenyl-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13)-dien-4-one |
| SMILES | CN1CCN(Cc2ccc([C@@H]3NC4CCCc5c4c(n[nH]c5=O)[C@H]3c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C28H33N5O/c1-32-14-16-33(17-15-32)18-19-10-12-21(13-11-19)26-24(20-6-3-2-4-7-20)27-25-22(28(34)31-30-27)8-5-9-23(25)29-26/h2-4,6-7,10-13,23-24,26,29H,5,8-9,14-18H2,1H3,(H,31,34)/t23?,24-,26-/m0/s1 |
| InChIKey | TVOZEAMLALGRRY-VNNQTNQMSA-N |
| XLogP | 3.37 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |