C28H40N2O6S — CID 53340920
hexanedioic acid;N-[4-(methoxymethyl)-1-(2-thiophen-2-ylethyl)piperidin-4-yl]-N-phenylpropanamide (PubChem CID 53340920) has the molecular formula C28H40N2O6S and a molecular weight of 532.70 g/mol. Its IUPAC name is hexanedioic acid;N-[4-(methoxymethyl)-1-(2-thiophen-2-ylethyl)piperidin-4-yl]-N-phenylpropanamide.
| Compound Name | hexanedioic acid;N-[4-(methoxymethyl)-1-(2-thiophen-2-ylethyl)piperidin-4-yl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 53340920 |
| Molecular Formula | C28H40N2O6S |
| Molecular Weight | 532.70 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | hexanedioic acid;N-[4-(methoxymethyl)-1-(2-thiophen-2-ylethyl)piperidin-4-yl]-N-phenylpropanamide |
| SMILES | CCC(=O)N(c1ccccc1)C1(COC)CCN(CCc2cccs2)CC1.O=C(O)CCCCC(=O)O |
| InChI | InChI=1S/C22H30N2O2S.C6H10O4/c1-3-21(25)24(19-8-5-4-6-9-19)22(18-26-2)12-15-23(16-13-22)14-11-20-10-7-17-27-20;7-5(8)3-1-2-4-6(9)10/h4-10,17H,3,11-16,18H2,1-2H3;1-4H2,(H,7,8)(H,9,10) |
| InChIKey | SKIULBCIQMPLCE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.70 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|