C21H28N2O2S — CID 59152834
3,3,3-trideuterio-N-[1-(2,2-dideuterio-2-thiophen-2-ylethyl)-4-methoxypiperidin-4-yl]-N-phenylpropanamide (PubChem CID 59152834) has the molecular formula C21H28N2O2S and a molecular weight of 377.56 g/mol. Its IUPAC name is 3,3,3-trideuterio-N-[1-(2,2-dideuterio-2-thiophen-2-ylethyl)-4-methoxypiperidin-4-yl]-N-phenylpropanamide.
| Compound Name | 3,3,3-trideuterio-N-[1-(2,2-dideuterio-2-thiophen-2-ylethyl)-4-methoxypiperidin-4-yl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 59152834 |
| Molecular Formula | C21H28N2O2S |
| Molecular Weight | 377.56 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 3,3,3-trideuterio-N-[1-(2,2-dideuterio-2-thiophen-2-ylethyl)-4-methoxypiperidin-4-yl]-N-phenylpropanamide |
| SMILES | [2H]C([2H])([2H])CC(=O)N(c1ccccc1)C1(OC)CCN(CC([2H])([2H])c2cccs2)CC1 |
| InChI | InChI=1S/C21H28N2O2S/c1-3-20(24)23(18-8-5-4-6-9-18)21(25-2)12-15-22(16-13-21)14-11-19-10-7-17-26-19/h4-10,17H,3,11-16H2,1-2H3/i1D3,11D2 |
| InChIKey | SLAXQMBUNKMKDL-JIZANVDTSA-N |
| XLogP | 4.17 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.56 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|