C22H31N3O2S — CID 156786663
3-amino-N-[4-(methoxymethyl)-1-(2-thiophen-2-ylethyl)piperidin-4-yl]-N-phenylpropanamide (PubChem CID 156786663) has the molecular formula C22H31N3O2S and a molecular weight of 401.58 g/mol. Its IUPAC name is 3-amino-N-[4-(methoxymethyl)-1-(2-thiophen-2-ylethyl)piperidin-4-yl]-N-phenylpropanamide.
| Compound Name | 3-amino-N-[4-(methoxymethyl)-1-(2-thiophen-2-ylethyl)piperidin-4-yl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 156786663 |
| Molecular Formula | C22H31N3O2S |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 3-amino-N-[4-(methoxymethyl)-1-(2-thiophen-2-ylethyl)piperidin-4-yl]-N-phenylpropanamide |
| SMILES | COCC1(N(C(=O)CCN)c2ccccc2)CCN(CCc2cccs2)CC1 |
| InChI | InChI=1S/C22H31N3O2S/c1-27-18-22(25(21(26)9-13-23)19-6-3-2-4-7-19)11-15-24(16-12-22)14-10-20-8-5-17-28-20/h2-8,17H,9-16,18,23H2,1H3 |
| InChIKey | XXFHURWMUJDCEF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |