C20H30N6O3 — CID 44621675
N-[1-[2,2-dideuterio-2-(4-ethyl-5-oxotetrazol-1-yl)ethyl]-4-methoxypiperidin-4-yl]-N-phenylpropanamide (PubChem CID 44621675) has the molecular formula C20H30N6O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is N-[1-[2,2-dideuterio-2-(4-ethyl-5-oxotetrazol-1-yl)ethyl]-4-methoxypiperidin-4-yl]-N-phenylpropanamide.
| Compound Name | N-[1-[2,2-dideuterio-2-(4-ethyl-5-oxotetrazol-1-yl)ethyl]-4-methoxypiperidin-4-yl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 44621675 |
| Molecular Formula | C20H30N6O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | N-[1-[2,2-dideuterio-2-(4-ethyl-5-oxotetrazol-1-yl)ethyl]-4-methoxypiperidin-4-yl]-N-phenylpropanamide |
| SMILES | [2H]C([2H])(CN1CCC(OC)(N(C(=O)CC)c2ccccc2)CC1)n1nnn(CC)c1=O |
| InChI | InChI=1S/C20H30N6O3/c1-4-18(27)26(17-9-7-6-8-10-17)20(29-3)11-13-23(14-12-20)15-16-25-19(28)24(5-2)21-22-25/h6-10H,4-5,11-16H2,1-3H3/i16D2 |
| InChIKey | ZKZHWTFPVIUOSK-BPPAMHLBSA-N |
| XLogP | 1.34 |
| TPSA | 85.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|