C21H28N2O2S — CID 44621053
2,2-dideuterio-N-[1-(2,2-dideuterio-2-thiophen-2-ylethyl)-4-methoxypiperidin-4-yl]-N-(2,3,4,5,6-pentadeuteriophenyl)propanamide (PubChem CID 44621053) has the molecular formula C21H28N2O2S and a molecular weight of 381.59 g/mol. Its IUPAC name is 2,2-dideuterio-N-[1-(2,2-dideuterio-2-thiophen-2-ylethyl)-4-methoxypiperidin-4-yl]-N-(2,3,4,5,6-pentadeuteriophenyl)propanamide.
| Compound Name | 2,2-dideuterio-N-[1-(2,2-dideuterio-2-thiophen-2-ylethyl)-4-methoxypiperidin-4-yl]-N-(2,3,4,5,6-pentadeuteriophenyl)propanamide |
|---|---|
| PubChem CID | 44621053 |
| Molecular Formula | C21H28N2O2S |
| Molecular Weight | 381.59 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 2,2-dideuterio-N-[1-(2,2-dideuterio-2-thiophen-2-ylethyl)-4-methoxypiperidin-4-yl]-N-(2,3,4,5,6-pentadeuteriophenyl)propanamide |
| SMILES | [2H]c1c([2H])c([2H])c(N(C(=O)C([2H])([2H])C)C2(OC)CCN(CC([2H])([2H])c3cccs3)CC2)c([2H])c1[2H] |
| InChI | InChI=1S/C21H28N2O2S/c1-3-20(24)23(18-8-5-4-6-9-18)21(25-2)12-15-22(16-13-21)14-11-19-10-7-17-26-19/h4-10,17H,3,11-16H2,1-2H3/i3D2,4D,5D,6D,8D,9D,11D2 |
| InChIKey | SLAXQMBUNKMKDL-CYILDEOYSA-N |
| XLogP | 4.17 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.59 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|