C40H46F12NO8P — CID 53342409
bis[[4-(trifluoromethyl)phenyl]methyl]azanium;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene;hexafluorophosphate (PubChem CID 53342409) has the molecular formula C40H46F12NO8P and a molecular weight of 927.76 g/mol. Its IUPAC name is bis[[4-(trifluoromethyl)phenyl]methyl]azanium;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene;hexafluorophosphate.
| Compound Name | bis[[4-(trifluoromethyl)phenyl]methyl]azanium;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene;hexafluorophosphate |
|---|---|
| PubChem CID | 53342409 |
| Molecular Formula | C40H46F12NO8P |
| Molecular Weight | 927.76 g/mol |
| Exact Mass | 927.28 |
| IUPAC Name | bis[[4-(trifluoromethyl)phenyl]methyl]azanium;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene;hexafluorophosphate |
| SMILES | FC(F)(F)c1ccc(C[NH2+]Cc2ccc(C(F)(F)F)cc2)cc1.F[P-](F)(F)(F)(F)F.c1ccc2c(c1)OCCOCCOCCOc1ccccc1OCCOCCOCCO2 |
| InChI | InChI=1S/C24H32O8.C16H13F6N.F6P/c1-2-6-22-21(5-1)29-17-13-25-9-10-27-15-19-31-23-7-3-4-8-24(23)32-20-16-28-12-11-26-14-18-30-22;17-15(18,19)13-5-1-11(2-6-13)9-23-10-12-3-7-14(8-4-12)16(20,21)22;1-7(2,3,4,5)6/h1-8H,9-20H2;1-8,23H,9-10H2;/q;;-1/p+1 |
| InChIKey | OESAITNUZAIPCU-UHFFFAOYSA-O |
| XLogP | 10.35 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 927.76 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|