C35H46F6NO10P — CID 139181669
dibenzylazanium;2,5,8,11,15,18,21,24-octaoxabicyclo[23.4.0]nonacosa-1(29),25,27-triene-12,14-dione;hexafluorophosphate (PubChem CID 139181669) has the molecular formula C35H46F6NO10P and a molecular weight of 785.71 g/mol. Its IUPAC name is dibenzylazanium;2,5,8,11,15,18,21,24-octaoxabicyclo[23.4.0]nonacosa-1(29),25,27-triene-12,14-dione;hexafluorophosphate.
| Compound Name | dibenzylazanium;2,5,8,11,15,18,21,24-octaoxabicyclo[23.4.0]nonacosa-1(29),25,27-triene-12,14-dione;hexafluorophosphate |
|---|---|
| PubChem CID | 139181669 |
| Molecular Formula | C35H46F6NO10P |
| Molecular Weight | 785.71 g/mol |
| Exact Mass | 785.28 |
| IUPAC Name | dibenzylazanium;2,5,8,11,15,18,21,24-octaoxabicyclo[23.4.0]nonacosa-1(29),25,27-triene-12,14-dione;hexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.O=C1CC(=O)OCCOCCOCCOc2ccccc2OCCOCCOCCO1.c1ccc(C[NH2+]Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H30O10.C14H15N.F6P/c22-20-17-21(23)31-16-12-27-8-6-25-10-14-29-19-4-2-1-3-18(19)28-13-9-24-5-7-26-11-15-30-20;1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;1-7(2,3,4,5)6/h1-4H,5-17H2;1-10,15H,11-12H2;/q;;-1/p+1 |
| InChIKey | ODXHMVLSAZWTMR-UHFFFAOYSA-O |
| XLogP | 6.33 |
| TPSA | 124.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.71 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|