C35H56F6NO9P — CID 71714308
(3,5-dimethylphenyl)methyl-(5-propanoyloxypentyl)azanium;2,5,8,11,14,17,20-heptaoxabicyclo[19.4.0]pentacosa-1(25),21,23-triene;hexafluorophosphate (PubChem CID 71714308) has the molecular formula C35H56F6NO9P and a molecular weight of 779.79 g/mol. Its IUPAC name is (3,5-dimethylphenyl)methyl-(5-propanoyloxypentyl)azanium;2,5,8,11,14,17,20-heptaoxabicyclo[19.4.0]pentacosa-1(25),21,23-triene;hexafluorophosphate.
| Compound Name | (3,5-dimethylphenyl)methyl-(5-propanoyloxypentyl)azanium;2,5,8,11,14,17,20-heptaoxabicyclo[19.4.0]pentacosa-1(25),21,23-triene;hexafluorophosphate |
|---|---|
| PubChem CID | 71714308 |
| Molecular Formula | C35H56F6NO9P |
| Molecular Weight | 779.79 g/mol |
| Exact Mass | 779.36 |
| IUPAC Name | (3,5-dimethylphenyl)methyl-(5-propanoyloxypentyl)azanium;2,5,8,11,14,17,20-heptaoxabicyclo[19.4.0]pentacosa-1(25),21,23-triene;hexafluorophosphate |
| SMILES | CCC(=O)OCCCCC[NH2+]Cc1cc(C)cc(C)c1.F[P-](F)(F)(F)(F)F.c1ccc2c(c1)OCCOCCOCCOCCOCCOCCO2 |
| InChI | InChI=1S/C18H28O7.C17H27NO2.F6P/c1-2-4-18-17(3-1)24-15-13-22-11-9-20-7-5-19-6-8-21-10-12-23-14-16-25-18;1-4-17(19)20-9-7-5-6-8-18-13-16-11-14(2)10-15(3)12-16;1-7(2,3,4,5)6/h1-4H,5-16H2;10-12,18H,4-9,13H2,1-3H3;/q;;-1/p+1 |
| InChIKey | SARCCTDPGCULDY-UHFFFAOYSA-O |
| XLogP | 7.41 |
| TPSA | 107.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.79 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|