C46H58NO12+ — CID 163821869
2-(3,5-dimethylbenzoyl)oxyethyl-[2-(3,5-dimethylbenzoyl)oxy-2-(2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaen-6-yl)ethyl]azanium (PubChem CID 163821869) has the molecular formula C46H58NO12+ and a molecular weight of 816.97 g/mol. Its IUPAC name is 2-(3,5-dimethylbenzoyl)oxyethyl-[2-(3,5-dimethylbenzoyl)oxy-2-(2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaen-6-yl)ethyl]azanium.
| Compound Name | 2-(3,5-dimethylbenzoyl)oxyethyl-[2-(3,5-dimethylbenzoyl)oxy-2-(2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaen-6-yl)ethyl]azanium |
|---|---|
| PubChem CID | 163821869 |
| Molecular Formula | C46H58NO12+ |
| Molecular Weight | 816.97 g/mol |
| Exact Mass | 816.40 |
| IUPAC Name | 2-(3,5-dimethylbenzoyl)oxyethyl-[2-(3,5-dimethylbenzoyl)oxy-2-(2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaen-6-yl)ethyl]azanium |
| SMILES | Cc1cc(C)cc(C(=O)OCC[NH2+]CC(OC(=O)c2cc(C)cc(C)c2)C2COCCOc3ccccc3OCCOCCOCCOc3ccccc3OCCO2)c1 |
| InChI | InChI=1S/C46H57NO12/c1-33-25-34(2)28-37(27-33)45(48)58-14-13-47-31-43(59-46(49)38-29-35(3)26-36(4)30-38)44-32-52-19-22-55-40-10-6-5-9-39(40)53-20-17-50-15-16-51-18-21-54-41-11-7-8-12-42(41)56-23-24-57-44/h5-12,25-30,43-44,47H,13-24,31-32H2,1-4H3/p+1 |
| InChIKey | NWCGXZAHWZTAMG-UHFFFAOYSA-O |
| XLogP | 5.23 |
| TPSA | 143.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.97 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|