C23H28O9 — CID 12883219
2-(2,6,13,16,19,22-hexaoxatricyclo[21.4.0.07,12]heptacosa-1(27),7,9,11,23,25-hexaen-4-yloxy)acetic acid (PubChem CID 12883219) has the molecular formula C23H28O9 and a molecular weight of 448.47 g/mol. Its IUPAC name is 2-(2,6,13,16,19,22-hexaoxatricyclo[21.4.0.07,12]heptacosa-1(27),7,9,11,23,25-hexaen-4-yloxy)acetic acid.
| Compound Name | 2-(2,6,13,16,19,22-hexaoxatricyclo[21.4.0.07,12]heptacosa-1(27),7,9,11,23,25-hexaen-4-yloxy)acetic acid |
|---|---|
| PubChem CID | 12883219 |
| Molecular Formula | C23H28O9 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 2-(2,6,13,16,19,22-hexaoxatricyclo[21.4.0.07,12]heptacosa-1(27),7,9,11,23,25-hexaen-4-yloxy)acetic acid |
| SMILES | O=C(O)COC1COc2ccccc2OCCOCCOCCOc2ccccc2OC1 |
| InChI | InChI=1S/C23H28O9/c24-23(25)17-30-18-15-31-21-7-3-1-5-19(21)28-13-11-26-9-10-27-12-14-29-20-6-2-4-8-22(20)32-16-18/h1-8,18H,9-17H2,(H,24,25) |
| InChIKey | VUSJWLNVGJNTMN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |