C27H36O8 — CID 12883222
2-(2,6,13,16,19-pentaoxatricyclo[18.4.0.07,12]tetracosa-1(24),7,9,11,20,22-hexaen-4-yloxy)octanoic acid (PubChem CID 12883222) has the molecular formula C27H36O8 and a molecular weight of 488.58 g/mol. Its IUPAC name is 2-(2,6,13,16,19-pentaoxatricyclo[18.4.0.07,12]tetracosa-1(24),7,9,11,20,22-hexaen-4-yloxy)octanoic acid.
| Compound Name | 2-(2,6,13,16,19-pentaoxatricyclo[18.4.0.07,12]tetracosa-1(24),7,9,11,20,22-hexaen-4-yloxy)octanoic acid |
|---|---|
| PubChem CID | 12883222 |
| Molecular Formula | C27H36O8 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | 2-(2,6,13,16,19-pentaoxatricyclo[18.4.0.07,12]tetracosa-1(24),7,9,11,20,22-hexaen-4-yloxy)octanoic acid |
| SMILES | CCCCCCC(OC1COc2ccccc2OCCOCCOc2ccccc2OC1)C(=O)O |
| InChI | InChI=1S/C27H36O8/c1-2-3-4-5-14-26(27(28)29)35-21-19-33-24-12-8-6-10-22(24)31-17-15-30-16-18-32-23-11-7-9-13-25(23)34-20-21/h6-13,21,26H,2-5,14-20H2,1H3,(H,28,29) |
| InChIKey | NMNTUWWOQFJWGH-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|