C36H58F6NO9P — CID 71714445
5-butanoyloxypentyl-[(3,5-dimethylphenyl)methyl]azanium;2,5,8,11,14,17,20-heptaoxabicyclo[19.4.0]pentacosa-1(25),21,23-triene;hexafluorophosphate (PubChem CID 71714445) has the molecular formula C36H58F6NO9P and a molecular weight of 793.82 g/mol. Its IUPAC name is 5-butanoyloxypentyl-[(3,5-dimethylphenyl)methyl]azanium;2,5,8,11,14,17,20-heptaoxabicyclo[19.4.0]pentacosa-1(25),21,23-triene;hexafluorophosphate.
| Compound Name | 5-butanoyloxypentyl-[(3,5-dimethylphenyl)methyl]azanium;2,5,8,11,14,17,20-heptaoxabicyclo[19.4.0]pentacosa-1(25),21,23-triene;hexafluorophosphate |
|---|---|
| PubChem CID | 71714445 |
| Molecular Formula | C36H58F6NO9P |
| Molecular Weight | 793.82 g/mol |
| Exact Mass | 793.38 |
| IUPAC Name | 5-butanoyloxypentyl-[(3,5-dimethylphenyl)methyl]azanium;2,5,8,11,14,17,20-heptaoxabicyclo[19.4.0]pentacosa-1(25),21,23-triene;hexafluorophosphate |
| SMILES | CCCC(=O)OCCCCC[NH2+]Cc1cc(C)cc(C)c1.F[P-](F)(F)(F)(F)F.c1ccc2c(c1)OCCOCCOCCOCCOCCOCCO2 |
| InChI | InChI=1S/C18H29NO2.C18H28O7.F6P/c1-4-8-18(20)21-10-7-5-6-9-19-14-17-12-15(2)11-16(3)13-17;1-2-4-18-17(3-1)24-15-13-22-11-9-20-7-5-19-6-8-21-10-12-23-14-16-25-18;1-7(2,3,4,5)6/h11-13,19H,4-10,14H2,1-3H3;1-4H,5-16H2;/q;;-1/p+1 |
| InChIKey | BOBSHVXVBXKOLX-UHFFFAOYSA-O |
| XLogP | 7.80 |
| TPSA | 107.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.82 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|