C11H8ClF4NO3S — CID 53343218
(4R)-3-[(S)-(2-chloro-1,1,2,2-tetrafluoroethyl)sulfinyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 53343218) has the molecular formula C11H8ClF4NO3S and a molecular weight of 345.70 g/mol. Its IUPAC name is (4R)-3-[(S)-(2-chloro-1,1,2,2-tetrafluoroethyl)sulfinyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(S)-(2-chloro-1,1,2,2-tetrafluoroethyl)sulfinyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 53343218 |
| Molecular Formula | C11H8ClF4NO3S |
| Molecular Weight | 345.70 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | (4R)-3-[(S)-(2-chloro-1,1,2,2-tetrafluoroethyl)sulfinyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | O=C1OC[C@@H](c2ccccc2)N1[S@@](=O)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C11H8ClF4NO3S/c12-10(13,14)11(15,16)21(19)17-8(6-20-9(17)18)7-4-2-1-3-5-7/h1-5,8H,6H2/t8-,21-/m0/s1 |
| InChIKey | BCKSFFLKKGZLQB-PPRQPISWSA-N |
| XLogP | 3.27 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.70 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|