C16H15ClF7NO2S — CID 50916628
(2S,4R)-1-[(S)-(2-chloro-1,1,2,2-tetrafluoroethyl)sulfinyl]-2-ethoxy-4-phenyl-6-(trifluoromethyl)-3,4-dihydro-2H-pyridine (PubChem CID 50916628) has the molecular formula C16H15ClF7NO2S and a molecular weight of 453.81 g/mol. Its IUPAC name is (2S,4R)-1-[(S)-(2-chloro-1,1,2,2-tetrafluoroethyl)sulfinyl]-2-ethoxy-4-phenyl-6-(trifluoromethyl)-3,4-dihydro-2H-pyridine.
| Compound Name | (2S,4R)-1-[(S)-(2-chloro-1,1,2,2-tetrafluoroethyl)sulfinyl]-2-ethoxy-4-phenyl-6-(trifluoromethyl)-3,4-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 50916628 |
| Molecular Formula | C16H15ClF7NO2S |
| Molecular Weight | 453.81 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | (2S,4R)-1-[(S)-(2-chloro-1,1,2,2-tetrafluoroethyl)sulfinyl]-2-ethoxy-4-phenyl-6-(trifluoromethyl)-3,4-dihydro-2H-pyridine |
| SMILES | CCO[C@H]1C[C@@H](c2ccccc2)C=C(C(F)(F)F)N1[S@@](=O)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C16H15ClF7NO2S/c1-2-27-13-9-11(10-6-4-3-5-7-10)8-12(14(18,19)20)25(13)28(26)16(23,24)15(17,21)22/h3-8,11,13H,2,9H2,1H3/t11-,13-,28-/m0/s1 |
| InChIKey | POQTYKWFWFCKDK-KQUADXFBSA-N |
| XLogP | 5.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.81 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|