C19H27NO2 — CID 13258742
1-benzyl-5-ethoxy-3-[(E)-hex-3-enyl]pyrrolidin-2-one (PubChem CID 13258742) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is 1-benzyl-5-ethoxy-3-[(E)-hex-3-enyl]pyrrolidin-2-one.
| Compound Name | 1-benzyl-5-ethoxy-3-[(E)-hex-3-enyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 13258742 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | 1-benzyl-5-ethoxy-3-[(E)-hex-3-enyl]pyrrolidin-2-one |
| SMILES | CC/C=C/CCC1CC(OCC)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C19H27NO2/c1-3-5-6-10-13-17-14-18(22-4-2)20(19(17)21)15-16-11-8-7-9-12-16/h5-9,11-12,17-18H,3-4,10,13-15H2,1-2H3/b6-5+ |
| InChIKey | HJKLHBREBBPIAU-AATRIKPKSA-N |
| XLogP | 4.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|